
CAS 73112-09-1: 2-cyanopyridine-3-carboxylic acid
Formula:C7H4N2O2
InChI:InChI=1/C7H4N2O2/c8-4-6-5(7(10)11)2-1-3-9-6/h1-3H,(H,10,11)
SMILES:C1=CC(=C(C#N)N=C1)C(=O)O
Synonyms:- 2-Cyanonicotinic acid
- 3-Pyridinecarboxylic Acid, 2-Cyano-
Sort by
Found 4 products.
2-Cyanonicotinic acid
CAS:2-Cyanonicotinic acid is a heterocyclic organic compound that contains both a pyridine and a pyrrolidine ring. It has been found in the fungus Aspergillus pyrinus. The compound has been shown to have potential as an anti-cancer agent, through inhibition of DNA synthesis and RNA transcription. 2-Cyanonicotinic acid has also been shown to inhibit cell growth in culture by acting on the enzyme cytochrome P450, which is involved in oxidative metabolism. This may be due to its ability to form a tautomer with 2-cyanoacrylic acid, which can hydrogen bond with the amino group of the enzyme and displace oxygen from the hydroxyl group.Formula:C7H4N2O2Purity:Min. 95%Molecular weight:148.12 g/molRef: 3D-FC140825
Discontinued product2-Cyanopyridine-3-carboxylic acid
CAS:2-Cyanopyridine-3-carboxylic acidPurity:95%Molecular weight:148.12g/mol