CAS 7397-06-0: 4-(1,1-Dimethylethyl)-1,2-dimethylbenzene
Formula:C12H18
InChI:InChI=1S/C12H18/c1-9-6-7-11(8-10(9)2)12(3,4)5/h6-8H,1-5H3
InChI key:InChIKey=QRPPSTNABSMSCS-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(C)=C(C)C=C1
Synonyms:- 1,2-Dimethyl-4-(1,1-dimethylethyl)benzene
- 1,2-Dimethyl-4-tert-butylbenzene
- 1-tert-Butyl-3,4-dimethylbenzene
- 3,4-Dimethyl-1-tert-butylbenzene
- 4-(1,1-Dimethylethyl)-1,2-dimethylbenzene
- 4-tert-Butyl-1,2-dimethylbenzene
- Benzene, 4-(1,1-dimethylethyl)-1,2-dimethyl-
- Butylxylene
- o-Xylene, 4-tert-butyl-
- 4-tert-Butyl-o-xylene
Sort by
Found 5 products.
4-tert-Butyl-o-xylene
CAS:Formula:C12H18Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:162.284-(tert-Butyl)-1,2-dimethylbenzene
CAS:Purity:95.0%Color and Shape:LiquidMolecular weight:162.27600097656254-tert-Butyl-o-xylene
CAS:4-tert-Butyl-o-xylene is a reactive molecule that reacts with oxygen to form a carbonyl group. It has been used in the synthesis of other chemicals and as a solvent for dyes and pesticides. 4-tert-Butyl-o-xylene is also used as a substrate binding agent in computational methods, such as molecular dynamics simulations, which are used to study reaction mechanisms and properties. This substance has been shown to inhibit the growth of cancer cells in vitro by reacting with DNA molecules. 4-tert-Butyl-o-xylene is also photophysical, meaning it absorbs light at specific wavelengths, making it an ideal candidate for use in optical devices such as lasers or LEDs.Formula:C12H18Purity:Min. 95%Molecular weight:162.28 g/mol
