
CAS 740810-42-8: 5-(1,1-Dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one
Formula:C23H24O6
InChI:InChI=1S/C23H24O6/c1-6-23(4,5)19-14(25)9-13(24)18-21(28)17-12(8-7-11(2)3)20(27)15(26)10-16(17)29-22(18)19/h6-7,9-10,24-27H,1,8H2,2-5H3
InChI key:InChIKey=FUEJTEBWTNXAPG-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=C2C(OC=3C(C2=O)=C(O)C=C(O)C3C(C=C)(C)C)=CC(O)=C1O
Synonyms:- 5-(1,1-Dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one
- 9H-Xanthen-9-one, 5-(1,1-dimethyl-2-propen-1-yl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-buten-1-yl)-
- Cudratricusxanthone A
- 9H-Xanthen-9-one, 5-(1,1-dimethyl-2-propenyl)-2,3,6,8-tetrahydroxy-1-(3-methyl-2-butenyl)-
Sort by
Found 2 products.
Cudratricusxanthone A
CAS:Cudratricusxanthone A is a natural bioactive compound, specifically a xanthone, which is derived from the root bark of the plant Cudrania tricuspidata. This compound is renowned for its unique chemical structure and its biological activities, primarily attributed to its potent antioxidant and anti-inflammatory properties. The mode of action involves the inhibition of pro-inflammatory pathways and the scavenging of free radicals, thereby reducing oxidative stress and mitigating inflammatory responses at the cellular level. Cudratricusxanthone A is being investigated for various applications in the field of biomedicine, particularly for its potential therapeutic role in the prevention and treatment of chronic diseases such as cancer, cardiovascular disorders, and neurodegenerative diseases. Its ability to modulate signaling pathways and gene expression profiles makes it a promising candidate for drug development and functional food ingredients. Current research focuses on elucidating its molecular mechanisms and improving its bioavailability to enhance therapeutic efficacy. The increasing interest in natural compounds like Cudratricusxanthone A highlights the importance of integrating traditional medicinal knowledge with modern pharmacological approaches.Formula:C23H24O6Purity:Min. 95%Molecular weight:396.4 g/mol