![N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F492820-n-3-4-4-cyclohexylmethyl-sulfonyl-amino-butyl-1-piperazinyl-phenyl-acetamide.webp&w=3840&q=75)
CAS 740873-06-7: N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide
Formula:C23H38N4O3S
InChI:InChI=1S/C23H38N4O3S/c1-20(28)25-22-10-7-11-23(18-22)27-16-14-26(15-17-27)13-6-5-12-24-31(29,30)19-21-8-3-2-4-9-21/h7,10-11,18,21,24H,2-6,8-9,12-17,19H2,1H3,(H,25,28)
InChI key:InChIKey=SPWZXWDPAWDKQE-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C=C(N2CCN(CCCCNS(CC3CCCCC3)(=O)=O)CC2)C=CC1
Synonyms:- N-[3-[4-[4-[(Cyclohexylmethylsulfonyl)amino]butyl]piperazin-1-yl]phenyl]acetamide
- N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide
- Acetamide, N-[3-[4-[4-[[(cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]-
- Naluzotan
- PRX 00023
Sort by
Found 2 products.
Naluzotan
CAS:Naluzotan(PRX 00023) is a novel and potent 5-HT1A agonist with IC50 and Ki values of approximately 20 nM and 5.1 nM, respectively.Naluzotan is a potent hERG K+Formula:C23H38N4O3SPurity:100%Color and Shape:SolidMolecular weight:450.64Naluzotan
CAS:Naluzotan is a diagnostic agent that is used to identify the receptor binding of 5-HT2A receptors. It can be used for the diagnosis of diseases such as herpes simplex virus, depression, and schizophrenia. Naluzotan binds to 5-HT2A receptors, activating them and causing a chemical reaction. This activation leads to the production of serotonin, which will then bind to 5-HT1A receptors and inhibit serotonin reuptake. Naluzotan is metabolized in the liver by hepatic impairment, but does not affect the serotonergic system or amino function.Formula:C23H38N4O3SPurity:Min. 95%Molecular weight:450.6 g/mol