CAS 7415-22-7: Ada Monosodium
Formula:C6H9N2NaO5
InChI:InChI=1/C6H10N2O5.Na/c7-4(9)1-8(2-5(10)11)3-6(12)13;/h1-3H2,(H2,7,9)(H,10,11)(H,12,13);/q;+1/p-1
SMILES:C(C(=N)O)N(CC(=O)O)CC(=O)O.[Na]
Synonyms:- N-(2-Acetamido)Iminodiaceticacid
- Sodium [(2-Amino-2-Oxoethyl)(Carboxymethyl)Amino]Acetate
Sort by
Found 6 products.
N-(2-Acetamido)iminodiacetic acid monosodium salt
CAS:Formula:C6H9N2NaO5Purity:96%Color and Shape:LiquidMolecular weight:212.1358N-(2-Acetamido)iminodiacetic acid, monosodium salt
CAS:N-(2-Acetamido)iminodiacetic acid, monosodium saltPurity:>90%Molecular weight:212.14g/molN-(2-(Acetamido)iminodiacetic acid sodium salt
CAS:N-(2-(Acetamido)iminodiacetic acid sodium salt (NADAC) is a molecule that is used to reduce the average diameter of influenza virus particles. It is often used as an excipient in vaccine preparations and has been shown to be able to induce antigen-specific immune responses in mice. NADAC has been shown to be effective against the influenza virus, which can lead to pandemic outbreaks. NADAC is a supramolecular compound that has a particle size of 8 nm and a morphology of spherical particles. It binds to viral antigen and can be used for the treatment of influenza infections by preventing viral replication.Purity:Min. 95%Ref: 3D-FA37505
Discontinued productSodium 2-((2-amino-2-oxoethyl)(carboxymethyl)amino)acetate
CAS:Purity:95.0%Molecular weight:212.13699340820312
