
CAS 7424-72-8: 9-(naphthalen-2-yl)anthracene
Formula:C24H16
InChI:InChI=1/C24H16/c1-2-8-18-15-21(14-13-17(18)7-1)24-22-11-5-3-9-19(22)16-20-10-4-6-12-23(20)24/h1-16H
SMILES:c1ccc2cc(ccc2c1)c1c2ccccc2cc2ccccc12
Synonyms:- Anthracene, 9-(2-naphthalenyl)-
Sort by
Found 5 products.
9-(2-Naphthyl)anthracene
CAS:9-(2-Naphthyl)anthracene is a fluorescent imidazole derivative that undergoes bond cleavage upon exposure to light. The mechanism of this reaction involves the formation of an excited state which leads to the photodimerization of 9-(2-naphthyl)anthracene and the subsequent formation of a carbocation. This carbocation can then react with an electron-rich center, such as anthracene, to form a new cationic intermediate. The efficiency of this reaction is dependent on the temperature and the concentration of 9-(2-naphthyl)anthracene in the solution.Formula:C24H16Purity:Min. 95%Molecular weight:304.39 g/molRef: 3D-HAA42472
Discontinued product9-(Naphthalen-2-Yl)Anthracene
CAS:9-(Naphthalen-2-Yl)AnthracenePurity:98%Molecular weight:304.38g/mol9-(2-Naphthyl)anthracene
CAS:Formula:C24H16Purity:>98.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:304.39Anthracene,9-(2-naphthalenyl)-
CAS:Formula:C24H16Purity:98%Color and Shape:SolidMolecular weight:304.3838