
CAS 74560-05-7: Isomedicarpin
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-18-10-3-5-12-14(7-10)19-8-13-11-4-2-9(17)6-15(11)20-16(12)13/h2-7,13,16-17H,8H2,1H3/t13-,16-/m0/s1
InChI key:InChIKey=YHZDBBUEVZEOIY-BBRMVZONSA-N
SMILES:O(C)C=1C=C2C([C@]3([C@](C=4C(O3)=CC(O)=CC4)(CO2)[H])[H])=CC1
Synonyms:- (-)-8-Hydroxy-3-methoxypterocarpan
- (6aR,11aR)-6a,11a-Dihydro-3-methoxy-6H-benzofuro[3,2-c][1]benzopyran-9-ol
- 3-Methoxy-9-hydroxypterocarpan
- 6H-Benzofuro[3,2-c][1]benzopyran-9-ol,6a,11a-dihydro-3-methoxy-, (6aR-cis)-
- Isomedicarpin
- 6H-Benzofuro[3,2-c][1]benzopyran-9-ol, 6a,11a-dihydro-3-methoxy-, (6aR,11aR)-
Sort by
Found 4 products.
Isomedicarpin
CAS:Isomedicarpin is a flavonoid compound, which is naturally derived from plant sources. It is isolated predominantly from certain species within the Leguminosae family, where these compounds often play a role in the plant's defense mechanisms. The mode of action of isomedicarpin involves disrupting microbial cell membranes and interfering with essential biochemical pathways, which contributes to its antimicrobial efficacy. The applications of isomedicarpin are primarily focused on its potential use in the pharmaceutical industry. Researchers are actively investigating its efficacy as an antimicrobial agent, particularly in the development of treatments against resistant strains of bacteria and fungi. Additionally, its role as a bioactive compound is being explored in various formulations for dermatological applications due to its potential anti-inflammatory properties. While promising, further studies are necessary to fully elucidate its mechanisms and optimize its use in clinical settings. The exploration of such compounds offers exciting possibilities in the quest for novel therapeutic agents.Formula:C16H14O4Purity:Min. 95%Molecular weight:270.28 g/molIsomedicarpin
CAS:Isomedicarpin is a phytoalexin.Formula:C16H14O4Purity:98%Color and Shape:SolidMolecular weight:270.28