
CAS 74572-15-9: (2S)-2-Phenylmorpholine
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-2-4-9(5-3-1)10-8-11-6-7-12-10/h1-5,10-11H,6-8H2/t10-/m1/s1
InChI key:InChIKey=ZLNGFYDJXZZFJP-SNVBAGLBSA-N
SMILES:C1(=CC=CC=C1)[C@H]2CNCCO2
Synonyms:- (S)-2-Phenylmorpholine
- (2S)-2-Phenylmorpholine
- Morpholine, 2-phenyl-, (2S)-
- Morpholine, 2-phenyl-, (S)-
Sort by
Found 4 products.
(S)-2-Phenylmorpholine
CAS:(S)-2-Phenylmorpholine is a versatile compound with various applications. It is commonly used as an intermediate in the synthesis of arterolane maleate, a potent antimalarial drug. Additionally, it has been found to have potential interactions with statins and potassium channels. Its chemical structure also makes it suitable for use as a fatty acid derivative. In the field of research chemicals, (S)-2-Phenylmorpholine is often employed as a catalyst for various reactions. Its unique properties make it useful in the synthesis of compounds such as 5-hydroxymethylfurfural, furosemide maleate, and tenofovir hydrogen maleate. Furthermore, (S)-2-Phenylmorpholine has shown promise in the pharmaceutical industry. Studies have indicated its potential therapeutic effects in the treatment of conditions such as erectile dysfunction (when combined with sildenafil), anxiety disorders (when combined with lorazepam), and dopamine-related diseases. Overall, (Formula:C10H13NOPurity:Min. 95%Molecular weight:163.22 g/mol(S)-2-Phenylmorpholine
CAS:Formula:C10H13NOPurity:97%Color and Shape:SolidMolecular weight:163.21632000000005