CAS 74639-14-8: Liquiritin apioside
Formula:C26H30O13
InChI:InChI=1S/C26H30O13/c27-9-19-20(31)21(32)22(39-25-23(33)26(34,10-28)11-35-25)24(38-19)36-14-4-1-12(2-5-14)17-8-16(30)15-6-3-13(29)7-18(15)37-17/h1-7,17,19-25,27-29,31-34H,8-11H2/t17-,19+,20+,21-,22+,23-,24+,25-,26+/m0/s1
InChI key:InChIKey=FTVKHUHJWDMWIR-DWMQJYMWSA-N
SMILES:O([C@H]1[C@H](OC2=CC=C(C=C2)[C@H]3OC=4C(C(=O)C3)=CC=C(O)C4)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@H]5[C@H](O)[C@](CO)(O)CO5
Synonyms:- 4H-1-Benzopyran-4-one, 2-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-, (2S)-
- Liquiritin apioside
- Liquiritigenin 4′-O-apiosyl-O-glucoside
- 4H-1-Benzopyran-4-one, 2-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-, (S)-
- (2S)-2-[4-[(2-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-2,3-dihydro-7-hydroxy-4H-1-benzopyran-4-one
Sort by
Found 7 products.
Liquiritin apioside
CAS:Liquiritin Apioside is one of the main active components in Suan-Zao-Ren decoction as a treatment for insomnia.Formula:C26H30O13Purity:99.08% - 99.53%Color and Shape:SolidMolecular weight:550.51Liquiritin apioside
CAS:Liquiritin apioside is a flavonoid glycoside, which is predominantly derived from the root of Glycyrrhiza uralensis, commonly known as licorice. This compound acts primarily through its anti-inflammatory and antioxidant properties, which involve the modulation of various cellular pathways. Specifically, it influences the activity of inflammatory cytokines and oxidative stress markers, potentially inhibiting pathways such as nuclear factor-kappa B (NF-κB). Liquiritin apioside finds applications in the scientific research sector, particularly in studies focused on inflammatory processes, oxidative stress, and related metabolic pathways. Beyond research, it has been explored for potential therapeutic implications, such as in the attenuation of inflammation-related disorders. Its influence on cellular pathways makes it a subject of interest for developing new treatments for diseases where inflammation plays a critical role. As a natural compound, it offers insights into how traditional herbal medicines can inform modern pharmacological interventions, providing a bridge between historical usage and contemporary scientific investigation.Formula:C26H30O13Purity:Min. 95%Color and Shape:White PowderMolecular weight:550.51 g/molLiquiritin apioside
CAS:Formula:C26H30O13Purity:≥ 96.0%Color and Shape:White to off-white or faint yellow powderMolecular weight:550.51Liquiritin apioside
CAS:Natural glycosideFormula:C26H30O13Purity:≥ 85.0 % (HPLC)Molecular weight:550.51
