
CAS 7477-10-3: 6-chloro-5-nitropyridine-3-carboxylic acid
Formula:C6H3ClN2O4
InChI:InChI=1/C6H3ClN2O4/c7-5-4(9(12)13)1-3(2-8-5)6(10)11/h1-2H,(H,10,11)
SMILES:c1c(cnc(c1N(=O)=O)Cl)C(=O)O
Synonyms:- 3-Pyridinecarboxylic acid, 6-chloro-5-nitro-
- 6-Chloro-5-nitronicotinic acid
- 2-Chloro-3-nitro-5-pyridinecarboxylic acid
Sort by
Found 4 products.
6-Chloro-5-nitronicotinic acid
CAS:6-Chloro-5-nitronicotinic acid (6CNA) is a nicotinic acetylcholine receptor agonist that has been synthesized. It is used as an intermediate in the synthesis of other compounds, such as morpholine and acetylcholine. 6CNA binds to the primary amines on the surface of rat brain cells and causes their deamination, which results in the release of nitric oxide (NO). NO activates guanylate cyclase, leading to increased production of cyclic guanosine monophosphate (cGMP). This can lead to smooth muscle relaxation and dilated blood vessels. 6CNA also binds to chloride ions and alkylates them, forming a stable complex with high affinity for chloride ions.Formula:C6H3ClN2O4Purity:Min. 95%Molecular weight:202.55 g/mol6-Chloro-5-nitronicotinic acid
CAS:Formula:C6H3ClN2O4Purity:98%Color and Shape:SolidMolecular weight:202.552026-Chloro-5-nitronicotinic acid
CAS:6-Chloro-5-nitronicotinic acidFormula:C6H3ClN2O4Purity:95%Color and Shape:Yellow PowderMolecular weight:202.55g/mol6-Chloro-5-nitronicotinic acid
CAS:Purity:95.0%Color and Shape:Solid, Yellow powderMolecular weight:202.5500030517578