
CAS 75433-99-7: 6-methoxyquinoline-2-carboxylic acid
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-15-8-3-5-9-7(6-8)2-4-10(12-9)11(13)14/h2-6H,1H3,(H,13,14)
SMILES:COc1ccc2c(ccc(C(=O)O)n2)c1
Synonyms:- 2-Quinolinecarboxylic Acid, 6-Methoxy-
- 6-Methoxy-quinoline-2-carboxylic acid
- 6-Methoxyquinoline-2-carboxylic acid
Sort by
Found 3 products.
6-Methoxyquinoline-2-carboxylic acid
CAS:6-Methoxyquinoline-2-carboxylic acid (6MQ) is a cytotoxic agent that binds to DNA and inhibits transcription. It has high affinity for the sequence GACCCT, which is found in many genes encoding ribosomal RNA. 6MQ also acts by binding to the chromophore of nucleic acids and inhibiting their synthesis. This drug can bind to divalent metal ions and inhibit bacterial growth by preventing protein biosynthesis. 6MQ also has fluorescence properties, which may be used to monitor its concentration in cells. The compound's sequence can be determined using NMR spectroscopy, which provides information about the number of hydrogen atoms present on each carbon atom and the number of double bonds in each molecule.Formula:C11H9NO3Purity:Min. 95%Molecular weight:203.19 g/molRef: 3D-FM130284
Discontinued productRef: 10-F223010
1gTo inquire2gTo inquire5gTo inquire10gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire6-Methoxyquinoline-2-carboxylic acid
CAS:Formula:C11H9NO3Purity:95%Color and Shape:SolidMolecular weight:203.1941Ref: IN-DA005BIK
1g597.00€2gTo inquire5gTo inquire10gTo inquire15gTo inquire100mg166.00€250mg294.00€500mg548.00€