CAS 75567-38-3: 20-Deoxyingenol 3-angelate
Formula:C25H34O5
InChI:InChI=1S/C25H34O5/c1-8-12(2)22(28)30-21-14(4)11-24-15(5)10-17-18(23(17,6)7)16(20(24)27)9-13(3)19(26)25(21,24)29/h8-9,11,15-19,21,26,29H,10H2,1-7H3/b12-8-/t15-,16+,17-,18+,19-,21+,24+,25+/m1/s1
InChI key:InChIKey=UQOWJJGOQJONCI-MZRDIQIISA-N
SMILES:O[C@@]12[C@@]3(C(=O)[C@]([C@]4([C@@](C[C@H]3C)(C4(C)C)[H])[H])(C=C(C)[C@H]1O)[H])C=C(C)[C@@H]2OC(/C(=C\C)/C)=O
Synonyms:- 1H-2,8a-Methanocyclopenta[a]cyclopropa[e]cyclodecene,2-butenoic acid deriv.
- 2-Butenoic acid, 2-methyl-, (1aR,2S,5R,5aS,6S,8aS,9R,10aR)-1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-yl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-yl ester, [1aR-[1aα,2β,5β,5aβ,6β(Z),8aα,9α,10aα]]-
- 2-Butenoicacid, 2-methyl-,1a,2,5,5a,6,9,10,10a-octahydro-5,5a-dihydroxy-1,1,4,7,9-pentamethyl-11-oxo-1H-2,8a-methanocyclopenta[a]cyclopropa[e]cyclodecen-6-ylester, [1aR-[1aa,2b,5b,5ab,6b(Z),8aa,9a,10aa]]-
- 20-Deoxyingenol 3-angelate
- 3-Angeloyl-20-deoxyingenol
- 3-Angelyl-20-deoxyingenol
- 3β-O-Angeloyl-20-deoxyingenol
- Euphorbia factor H8
- Euphorbia factor H<sub>8</sub>
- Pep 006
Sort by
Found 3 products.
20-Deoxyingenol 3-angelate
CAS:20-Deoxyingenol 3-angelate promotes mouse skin tumors and induces platelet aggregation via PKC activation.Formula:C25H34O5Purity:98%Color and Shape:SolidMolecular weight:414.54220-Deoxyingenol 3-angelate
CAS:20-Deoxyingenol 3-angelate is a naturally derived diterpene ester, which is isolated from the Euphorbia species. This compound acts primarily by modulating the protein kinase C (PKC) pathway, which plays a critical role in cell signaling, proliferation, and differentiation. Its unique mode of action enables it to interfere with specific cellular processes, making it a promising candidate for research into cancer treatment and other proliferative disorders. In scientific studies, 20-Deoxyingenol 3-angelate has been shown to induce apoptosis in various cancer cell lines, highlighting its potential as an anti-cancer agent. Additionally, its ability to modulate immune responses suggests further applications in research areas such as immunotherapy and inflammation. This compound is thus of significant interest in the scientific community, particularly in pharmacological and biochemical research, where understanding its effects could lead to the development of innovative therapeutic strategies.Formula:C25H34O5Purity:Min. 95%Color and Shape:PowderMolecular weight:414.5 g/mol
