
CAS 76076-04-5: β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
Formula:C34H44O19
InChI:InChI=1S/C34H44O19/c1-15-24(42)28(52-33-30(45)34(46,13-36)14-48-33)25(43)32(49-15)53-29-26(44)31(47-9-8-17-3-6-19(38)21(40)11-17)50-22(12-35)27(29)51-23(41)7-4-16-2-5-18(37)20(39)10-16/h2-7,10-11,15,22,24-33,35-40,42-46H,8-9,12-14H2,1H3
InChI key:InChIKey=KAKUSAKVVYFENV-UHFFFAOYSA-N
SMILES:O(C1C(OC(C=CC2=CC(O)=C(O)C=C2)=O)C(CO)OC(OCCC3=CC(O)=C(O)C=C3)C1O)C4C(O)C(OC5C(O)C(CO)(O)CO5)C(O)C(C)O4
Synonyms:- Myricoside
- Clerodendroside (Clerodendron myricoides)
- Clerodendroside
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→3)-O-6-deoxy-α-L-mannopyranosyl-(1→3)-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
Sort by
Found 4 products.
Myricoside
CAS:Myricoside (C10479) is a natural product isolated from the aerial parts of Phlomis oppositiflora.Formula:C34H44O19Purity:98.56%Color and Shape:SolidMolecular weight:756.7Ref: TM-TN7085
1mg170.00€5mg349.00€10mg497.00€25mg805.00€50mg1,111.00€100mg1,501.00€1mL*10mM (DMSO)520.00€Myricoside
CAS:Myricoside is a glycoside compound, which is derived from the bark and leaves of the plant _Myrica rubra_, commonly known as the Chinese bayberry. This compound exhibits potential biological activities primarily due to its nature as a plant secondary metabolite with a specific chemical structure that fosters interactions at the cellular level. The mode of action of Myricoside involves its potential antioxidant activity, wherein it scavenges free radicals, thereby reducing oxidative stress within biological systems. Additionally, there is evidence suggesting anti-inflammatory properties, mediated through the modulation of signaling pathways involved in the inflammatory response. This is significant for cellular protection and the maintenance of homeostasis. In terms of applications, Myricoside is being researched for its use in pharmacological interventions, particularly for conditions related to oxidative stress and inflammation. Studies are focused on its incorporation into treatments for chronic diseases such as cardiovascular and neurodegenerative disorders. Its natural origin from _Myrica rubra_ makes it a subject of interest in the development of natural therapeutic agents in alternative and complementary medicine. Current research continues to explore its full potential and efficacy in various biological contexts.Formula:C34H44O19Purity:Min. 95%Molecular weight:756.7 g/mol