
CAS 766-47-2: 1-ethynyl-2-methylbenzene
Formula:C9H8
InChI:InChI=1/C9H8/c1-3-9-7-5-4-6-8(9)2/h1,4-7H,2H3
SMILES:C#Cc1ccccc1C
Synonyms:- 2-Methyl phenylacetylene
- 2-Ethynyltoluene
Sort by
Found 5 products.
2-Methylphenylacetylene
CAS:2-MethylphenylacetyleneFormula:C9H8Purity:95%Color and Shape: clear. colourless liquidMolecular weight:116.16g/mol2-Methylphenylacetylene
CAS:Formula:C9H8Purity:95%Color and Shape:LiquidMolecular weight:116.163g/mol1-Ethynyl-2-methylbenzene
CAS:Formula:C9H8Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:116.162-Ethynyltoluene
CAS:2-Ethynyltoluene is an organic compound that has been reported to be reactive with various compounds. This chemical has been shown to inhibit the phosphorylation of tyrosine residues on human insulin receptor, which is a key step in insulin signaling pathways. The phosphate group in 2-ethynyl-toluene can be removed by protonation, allowing the molecule to react with other molecules and form model complexes. This chemical also forms polymers when heated and coated onto surfaces.2-Ethynyltoluene is soluble in polar solvents such as water, alcohols, and acetone. 2-Ethynyltoluene has a molecular weight of 130.1 g/mol and a boiling point of 148°C at 760 mmHg.Formula:C9H8Purity:Min. 95%Molecular weight:116.16 g/mol