CAS 76783-59-0: Benzoic acid, 3-(trifluoromethyl)-, ethyl ester
Formula:C10H9F3O2
InChI:InChI=1S/C10H9F3O2/c1-2-15-9(14)7-4-3-5-8(6-7)10(11,12)13/h3-6H,2H2,1H3
InChI key:InChIKey=MHNBTKIAHHECCQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(C(F)(F)F)=CC=C1
Synonyms:- Benzoic acid, 3-(trifluoromethyl)-, ethyl ester
- Ethyl 3-(trifluoromethyl)benzoate
- Ethyl m-(trifluoromethyl)benzoate
- 3-(Trifluoromethyl)benzoic acid ethyl ester
Sort by
Found 4 products.
Ethyl 3-(trifluoromethyl)benzoate
CAS:Ethyl 3-(trifluoromethyl)benzoateFormula:C10H9F3O2Purity:97%Color and Shape: colourless liquidMolecular weight:218.17g/molEthyl 3-(TRIFLUOROMEthyl)Benzoate
CAS:Formula:C10H9F3O2Purity:97%Color and Shape:LiquidMolecular weight:218.1725Ethyl 3-(trifluoromethyl)benzoate
CAS:Purity:97.0%Color and Shape:LiquidMolecular weight:218.1750030517578Ethyl 3-(trifluoromethyl)benzoate
CAS:Ethyl 3-(trifluoromethyl)benzoate is an organic compound that belongs to the class of graphs. It has a chemical formula of C9H7F3O2 and molecular weight of 179.1 g/mol. The graph contains 4 atoms, with one atom in the center, 2 atoms on each side, and 1 atom at each end. The graph has a connectivity index of 0.5, meaning that it has no bonds between the atoms. This graph was calculated using the theory of atomic orbitals, which states that there are 8 electrons in this graph and they are placed around its nucleus in 4 different orbits or shells. There is a total of 6 atomic orbitals: sigma (σ), pi (π), lambda (λ), xi (ξ), eta (η) and omega (ω). These atomic orbitals have been weighted by their corresponding electron density to calculate the total electron density for this molecule. The weightingFormula:C10H9F3O2Purity:Min. 95%Molecular weight:218.17 g/mol
