
CAS 77099-20-8: 2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-chromen-5-yl 6-O-beta-D-xylopyranosyl-beta-D-glucopyranoside
Formula:C27H30O14
InChI:InChI=1/C27H30O14/c1-36-13-6-17-20(14(29)8-16(39-17)11-2-4-12(28)5-3-11)18(7-13)40-27-25(35)23(33)22(32)19(41-27)10-38-26-24(34)21(31)15(30)9-37-26/h2-8,15,19,21-28,30-35H,9-10H2,1H3/t15-,19-,21+,22-,23+,24-,25-,26+,27-/m1/s1
Synonyms:- 4H-1-Benzopyran-4-one, 2-(4-hydroxyphenyl)-7-methoxy-5-((6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy)-
- Genkwanin 5-O-primveroside
Sort by
Found 5 products.
4H-1-Benzopyran-4-one,2-(4-hydroxyphenyl)-7-methoxy-5-[(6-O-b-D-xylopyranosyl-b-D-glucopyranosyl)oxy]-
CAS:Formula:C27H30O14Purity:95%Color and Shape:SolidMolecular weight:578.5187Yuankanin
CAS:Yuankanin, a natural compound found in thyme leaves, Daphne gnidium and Daphne feddei, is a genkwanin-5-bioside with anthelmintic activity.Formula:C27H30O14Purity:98.38%Color and Shape:SolidMolecular weight:578.52Yuankanin
CAS:Controlled ProductYuankanin is an herbal extract derived from the bark of the Rhodoleia championii plant, which is native to subtropical regions. This botanical source has been traditionally used in various medicinal practices due to its bioactive compounds. The primary mode of action involves the inhibition of pro-inflammatory cytokines and the modulation of immune responses, which contributes to its proposed benefits in reducing inflammation. Yuankanin has been the subject of scientific studies that investigate its potential applications in managing inflammatory conditions, such as arthritis and other autoimmune disorders. Additionally, its properties may make it a candidate for further research into antioxidant activities. Researchers are particularly interested in understanding the specific pathways through which Yuankanin exerts its effects, aiming to identify novel therapeutic targets for chronic inflammatory diseases.Formula:C27H30O14Purity:Min. 95%Molecular weight:578.50 g/mol