![[(ethylsulfonyl)methyl]benzene](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F336596-ethylsulfonyl-methyl-benzene.webp&w=3840&q=75)
CAS 772-47-4: [(ethylsulfonyl)methyl]benzene
Formula:C9H12O2S
InChI:InChI=1/C9H12O2S/c1-2-12(10,11)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3
SMILES:CCS(=O)(=O)Cc1ccccc1
Synonyms:- Benzyl Ethyl Sulfone
Sort by
Found 2 products.
Ethylsulfonylmethylbenzene
CAS:Ethylsulfonylmethylbenzene is a cyclic organic compound that has been used as an anesthetic, sedative, and hypnotic drug. It binds to the cannabinoid receptors in the brain and alters mood and perception. Ethylsulfonylmethylbenzene is soluble in acetonitrile, vinylene, and tetrahydroisoquinolyl. The solubility of ethylsulfonylmethylbenzene in water is low, although it can be mixed with other solvents such as acetone or ethanol. This compound is typically found at ambient temperature but can also exist as a gas at temperatures below -10°C.Formula:C9H12O2SPurity:Min. 95%Molecular weight:184.26 g/mol