
CAS 77294-82-7: 1-(2-fluorophenyl)-2-phenyl-ethanone
Formula:C14H11FO
InChI:InChI=1/C14H11FO/c15-13-9-5-4-8-12(13)14(16)10-11-6-2-1-3-7-11/h1-9H,10H2
SMILES:c1ccc(cc1)CC(=O)c1ccccc1F
Sort by
Found 5 products.
2-Fluoro-N-phenylbenzamide
CAS:2-Fluoro-N-phenylbenzamide is an amide compound that has a fluorine atom as its central atom. The dihedral angle and molecular interactions of 2-fluoro-N-phenylbenzamide have been studied by conformational analysis and crystal structure analyses. There are two isomers of the compound, which can be differentiated by their conformations. The interactions between the fluorine atom and other atoms in the molecule have also been investigated using gas phase analysis and hydrogen bond studies. 2-Fluoro-N-phenylbenzamide has a conformation that is dependent on the number of hydrogen bonds it forms with its neighboring molecules. The permutations of this compound have also been studied to determine how they affect its conformation.Formula:C13H10FNOPurity:Min. 95%Molecular weight:215.22 g/mol