CAS 7730-87-2: 1-Methyl-2-piperidinecarboxylic acid
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-8-5-3-2-4-6(8)7(9)10/h6H,2-5H2,1H3,(H,9,10)
InChI key:InChIKey=BPSLZWSRHTULGU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1N(C)CCCC1
Synonyms:- 1-Methyl-2-piperidinecarboxylic acid
- 2-Piperidinecarboxylic acid, 1-methyl-, (±)-
- 2-Piperidinecarboxylic acid, 1-methyl-
- Pipecolic acid, 1-methyl-
- N-Methyl-2-piperidinecarboxylic acid
Sort by
Found 5 products.
1-Methylpiperidine-2-carboxylic acid
CAS:Formula:C7H13NO2Purity:95%Color and Shape:SolidMolecular weight:143.18361-Methylpiperidine-2-carboxylic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:143.186004638671881-Methylpiperidine-2-carboxylic acid
CAS:1-Methylpiperidine-2-carboxylic acid is a chemical compound that is used in the synthesis of oxindole derivatives and betaines. It has been shown to have anti-cancer properties and may be useful for the treatment of cancer. 1-Methylpiperidine-2-carboxylic acid inhibits the production of kynurenine, which is an endogenous molecule that can lead to the development of cancer cells. This compound also binds to molecular targets such as betaine and choline, which are involved in cancer cell proliferation.Formula:C7H13NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:143.18 g/molN-Methyl DL-Pipecolic Acid
CAS:Controlled ProductApplications Pipecolic Acid (P479760) derivative. Found in wheat, rye and barley.Formula:C7H13NO2Color and Shape:NeatMolecular weight:143.18
