
CAS 773876-05-4: methyl 2,3-difluoro-6-methoxy-benzoate
Formula:C9H8F2O3
InChI:InChI=1/C9H8F2O3/c1-13-6-4-3-5(10)8(11)7(6)9(12)14-2/h3-4H,1-2H3
SMILES:COc1ccc(c(c1C(=O)OC)F)F
Sort by
Found 1 products.
2,3-Difluoro-6-methoxybenzoic acid methyl ester
CAS:2,3-Difluoro-6-methoxybenzoic acid methyl ester is a versatile building block that can be used in the production of fine chemicals and research chemicals. It is an intermediate for the synthesis of complex compounds and can be used as a reagent or speciality chemical in research. 2,3-Difluoro-6-methoxybenzoic acid methyl ester is also a useful building block for the synthesis of drugs.Formula:C9H8F2O3Purity:Min. 95%Molecular weight:202.15 g/mol