
CAS 79769-48-5: (11-bromoundecyl)(trichloro)silanato(2-)
Formula:C11H22BrCl3Si
InChI:InChI=1/C11H22BrCl3Si/c12-10-8-6-4-2-1-3-5-7-9-11-16(13,14)15/h1-11H2
SMILES:C(CCCCCBr)CCCCC[Si](Cl)(Cl)Cl
Synonyms:- (11-Bromoundecyl)(trichloro)silane
- Silane, (11-bromoundecyl)trichloro-
Sort by
Found 5 products.
11-BROMOUNDECYLTRICHLOROSILANE, 95%
CAS:Formula:C11H22BrCl3SiPurity:95%Color and Shape:Straw LiquidMolecular weight:368.6411-Bromoundecyl trichlorosilane
CAS:Purity:>90%Color and Shape:Liquid, ClearMolecular weight:368.640014648437511-Bromoundecyltrichlorosilane
CAS:11-BromoundecyltrichlorosilanePurity:95%Molecular weight:368.64g/mol(11-Bromoundecyl)trichlorosilane
CAS:Formula:C11H22BrCl3SiPurity:>97.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:368.64(11-Bromoundecyl)trichlorosilane
CAS:Trichlorosilane is a compound that exists as a monolayer on the surface of metals. It is used in coatings, plastics, and other applications. Trichlorosylation is achieved by the reaction of an alcohol group with a proton and oxidation catalyst. The hydrogen chloride molecule reacts with the alcohol group and creates a reactive site for cross-linking reactions. This reaction mechanism can be classified as nucleophilic substitution of chlorine atom with an oxygen atom from the alcohol group. Trichlorosilane is oxidized to trichlorosilane oxide, which has different functional groups than trichlorosilane. These functional groups give it different properties, such as optical properties.Formula:C11H22BrCl3SiPurity:Min. 95%Molecular weight:368.64 g/mol