![3-methoxy-4-[(4-nitrobenzyl)oxy]benzaldehyde](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F202013-3-methoxy-4-4-nitrobenzyl-oxy-benzaldehyde.webp&w=3840&q=75)
CAS 81307-09-7: 3-methoxy-4-[(4-nitrobenzyl)oxy]benzaldehyde
Formula:C15H13NO5
InChI:InChI=1/C15H13NO5/c1-20-15-8-12(9-17)4-7-14(15)21-10-11-2-5-13(6-3-11)16(18)19/h2-9H,10H2,1H3
SMILES:COc1cc(ccc1OCc1ccc(cc1)N(=O)=O)C=O
Synonyms:- 3-Methoxy-4-(4-nitro-benzyloxy)-benzaldehyde
- 3-Methoxy-4-(P-Nitrobenzyloxy)Benzaldehyde
- Benzaldehyde, 3-methoxy-4-[(4-nitrophenyl)methoxy]-
Sort by
Found 3 products.
3-Methoxy-4-(4-nitrobenzyloxy)benzaldehyde
CAS:3-Methoxy-4-(4-nitrobenzyloxy)benzaldehyde is a chemical intermediate that is used in the synthesis of complex compounds. It has been shown to be an effective reagent for the synthesis of various organic compounds, such as pharmaceuticals and pesticides. 3-Methoxy-4-(4-nitrobenzyloxy)benzaldehyde is also used as a research chemical or as a speciality chemical in laboratories. This compound can be used as a building block in the synthesis of other compounds with interesting properties, such as 3-methoxy-4-(2,5-dichlorobenzyloxy)benzaldehyde.Formula:C15H13NO5Purity:Min. 95%Color and Shape:PowderMolecular weight:287.27 g/mol3-Methoxy-4-(4-nitrobenzyloxy)benzaldehyde
CAS:3-Methoxy-4-(4-nitrobenzyloxy)benzaldehydeMolecular weight:287.27g/mol