
CAS 81426-14-4: Acetoxypinoresinol
Formula:C22H24O8
InChI:InChI=1S/C22H24O8/c1-12(23)30-22-11-29-20(13-4-6-16(24)18(8-13)26-2)15(22)10-28-21(22)14-5-7-17(25)19(9-14)27-3/h4-9,15,20-21,24-25H,10-11H2,1-3H3/t15-,20-,21-,22-/m1/s1
InChI key:InChIKey=NATDFORNCKZPCI-FPHUIIFBSA-N
SMILES:O(C(C)=O)[C@@]12[C@@]([C@H](OC1)C3=CC(OC)=C(O)C=C3)(CO[C@@H]2C4=CC(OC)=C(O)C=C4)[H]
Synonyms:- (+)-Acetoxypinoresinol
- 1H,3H-Furo[3,4-c]furan-3a(4H)-ol, dihydro-1,4-bis(4-hydroxy-3-methoxyphenyl)-, 3a-acetate, [1S-(1α,3aα,4α,6aα)]-
- 1H,3H-Furo[3,4-c]furan-3a(4H)-ol, dihydro-1,4-bis(4-hydroxy-3-methoxyphenyl)-, 3a-acetate, (1S,3aS,4R,6aR)-
- (+)-1-Acetoxypinoresinol
- Acetoxypinoresinol
Sort by
Found 2 products.
8-Acetoxypinoresinol
CAS:Formula:C22H24O8Purity:95%~99%Color and Shape:PowderMolecular weight:416.4268-Acetoxypinoresinol
CAS:8-Acetoxypinoresinol is a lignan derivative, which is a type of polyphenolic compound primarily derived from plant sources, particularly in the seeds and stems of certain plants like flaxseeds and sesame. This compound is part of a subclass of phytoestrogens, which are plant-derived compounds with estrogenic activity. The mode of action of 8-Acetoxypinoresinol involves binding to estrogen receptors, where it can modulate the expression of estrogen-responsive genes. This can result in various physiological effects, such as antioxidant activity and modulation of enzymatic pathways involved in hormone metabolism. Its structural similarity to estrogen allows it to interact in ways that are both similar to and distinct from endogenous estrogens. In scientific research, 8-Acetoxypinoresinol is used to study its potential health benefits, such as its role in cancer prevention, cardiovascular health, and neuroprotective effects. Its ability to act as an antioxidant and modulate hormonal pathways makes it a subject of interest for developing therapeutic agents and understanding its potential protective roles in various diseases. By exploring these properties, scientists aim to elucidate its mechanisms and applicability in clinical contexts.Formula:C22H24O8Purity:Min. 95%Color and Shape:PowderMolecular weight:416.4 g/mol