CAS 81827-74-9: Neotriptophenolide
Formula:C21H26O4
InChI:InChI=1S/C21H26O4/c1-11(2)14-9-17(22)18-13(19(14)24-4)5-6-16-15-10-25-20(23)12(15)7-8-21(16,18)3/h9,11,16,22H,5-8,10H2,1-4H3/t16-,21-/m0/s1
InChI key:InChIKey=YQHBJMHUMJXFDN-KKSFZXQISA-N
SMILES:C[C@@]12C=3C(=C(OC)C(C(C)C)=CC3O)CC[C@]1(C4=C(CC2)C(=O)OC4)[H]
Synonyms:- Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR,9bS)-
- Neotriptophenolide
- (3bR,9bS)-3b,4,5,9b,10,11-Hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)phenanthro[1,2-c]furan-1(3H)-one
- Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-9-hydroxy-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR-trans)-
Sort by
Found 5 products.
Neotriptophenolide
CAS:Neotriptophenolide is a natural productFormula:C21H26O4Purity:99.46%Color and Shape:SolidMolecular weight:342.43Neotriptophenolide
CAS:Neotriptophenolide is a synthetic compound that belongs to the class of bioactive alkaloids. It is derived from a rational synthesis process, leveraging advanced organic chemistry techniques to replicate and improve upon naturally occurring compounds. The mode of action of Neotriptophenolide involves specific interactions with cellular receptors and enzymes, influencing various biochemical pathways essential for cellular regulation and signaling. In terms of applications, Neotriptophenolide shows promising potential in therapeutic research, particularly in fields such as neuropharmacology and oncology. Its ability to modulate specific cellular targets makes it a candidate for developing treatments aimed at neurological disorders and certain cancers. The compound's efficacy and specificity are under investigation in preclinical models, where it demonstrates a capacity to influence key pathological processes. Further research is ongoing to fully elucidate its mechanistic pathways and optimize its pharmacokinetic properties for possible therapeutic applications.Purity:Min. 95%
