CAS 83459-41-0: Ginsenoside Ra<sub>1</sub>
Formula:C58H98O26
InChI:InChI=1S/C58H98O26/c1-24(2)10-9-14-58(8,84-52-47(74)42(69)39(66)30(81-52)22-76-49-45(72)40(67)31(23-77-49)80-50-44(71)36(63)27(62)21-75-50)25-11-16-57(7)35(25)26(61)18-33-55(5)15-13-34(54(3,4)32(55)12-17-56(33,57)6)82-53-48(43(70)38(65)29(20-60)79-53)83-51-46(73)41(68)37(64)28(19-59)78-51/h10,25-53,59-74H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31-,32-,33+,34-,35-,36-,37+,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,48+,49+,50-,51-,52-,53-,55-,56+,57+,58-/m0/s1
InChI key:InChIKey=KVMXBSSOCCPAOR-WWJNHZDPSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@@H](O)[C@@H](O[C@H]6[C@H](O)[C@@H](O)[C@H](O)CO6)CO5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]7(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]8[C@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@@H](O)[C@H](O)[C@@H](CO)O8)CC7)[H])[H])[H]
Synonyms:- (3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→4)-O-α-L-arabinopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→4)-O-α-L-arabinopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
- Dammarane, β-D-glucopyranoside deriv.
- Ginsenoside Ra1
Sort by
Found 5 products.
Ginsenoside Ra1
CAS:Ginsenoside Ra1 is a component from ginseng.Formula:C58H98O26Purity:97.44%Color and Shape:SolidMolecular weight:1211.38Ginsenoside Ra1
CAS:Ginsenoside Ra1 is a naturally occurring saponin, which is derived from the roots of Panax ginseng. This compound falls under the category of ginsenosides, which are a class of triterpene glycosides notable for their diverse pharmacological effects. Ginsenoside Ra1 is sourced specifically from the root of the ginseng plant, a widely studied herb in traditional medicine, and is extracted using advanced chromatographic techniques to ensure purity. The mode of action of Ginsenoside Ra1 involves modulating various cellular signaling pathways. It is known to have a significant impact on the regulation of cell proliferation, apoptosis, and anti-inflammatory responses, primarily through the modulation of nuclear factor-kappa B (NF-κB) and mitogen-activated protein kinases (MAPKs). Moreover, it influences calcium ion channel activity, contributing to its broad therapeutic potential. Ginsenoside Ra1 is primarily utilized in research focused on uncovering the molecular mechanisms underlying its effects in oncology, neuroprotection, and immunomodulation. Its applications extend to the study of anti-cancer properties, aiding in the development of novel therapeutic strategies for cancer treatment. Additionally, it is a prominent subject in research targeting anti-inflammatory and antioxidant activities, contributing to the understanding of its potential as a therapeutic agent in chronic diseases.Formula:C58H98O26Purity:Min. 95%Molecular weight:1,211.4 g/mol
