
CAS 83459-42-1: Ginsenoside Ra2
Formula:C58H98O26
InChI:InChI=1S/C58H98O26/c1-24(2)10-9-14-58(8,84-51-46(74)42(70)39(67)31(80-51)23-76-52-47(40(68)30(21-61)78-52)82-49-44(72)36(64)27(63)22-75-49)25-11-16-57(7)35(25)26(62)18-33-55(5)15-13-34(54(3,4)32(55)12-17-56(33,57)6)81-53-48(43(71)38(66)29(20-60)79-53)83-50-45(73)41(69)37(65)28(19-59)77-50/h10,25-53,59-74H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30-,31+,32-,33+,34-,35-,36-,37+,38+,39+,40-,41-,42-,43-,44+,45+,46+,47+,48+,49-,50-,51-,52+,53-,55-,56+,57+,58-/m0/s1
InChI key:InChIKey=UEBIBJSWHIZNCA-BGPUAMRSSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O[C@H]6[C@H](O)[C@@H](O)[C@H](O)CO6)[C@@H](O)[C@H](CO)O5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]7(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@H]8[C@H](O[C@@H]9O[C@H](CO)[C@@H](O)[C@H](O)[C@H]9O)[C@@H](O)[C@H](O)[C@@H](CO)O8)CC7)[H])[H])[H]
Synonyms:- Dammarane, β-D-glucopyranoside deriv.
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→2)-O-α-L-arabinofuranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
- (3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→2)-O-α-L-arabinofuranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
- Ginsenoside Ra2
- Notoginsenoside Ra2
Sort by
Found 5 products.
Ginsenoside Ra2
CAS:Ginsenoside Ra2 is a natural productFormula:C58H98O26Purity:98%Color and Shape:SolidMolecular weight:1211.396Ginsenoside Ra2
CAS:Ginsenoside Ra2 is a steroidal saponin, which is a type of glycoside compound. It is primarily sourced from Panax ginseng, a well-known medicinal plant extensively utilized in traditional medicine. The compound exhibits a complex mode of action, primarily involving modulation of cellular pathways through interaction with specific cell membrane receptors and enzymes. This interaction influences various signal transduction pathways, such as the MAPK and PI3K/Akt pathways, which are crucial for regulating cellular processes like proliferation, apoptosis, and differentiation. Ginsenoside Ra2 has garnered significant attention for its potential therapeutic applications. It exhibits a range of pharmacological effects, including anti-inflammatory, antioxidant, and anticancer activities. In cancer research, it is studied for its ability to inhibit tumor cell growth and induce apoptosis in various cancer cell lines. Its anti-inflammatory properties are investigated in the context of chronic inflammatory diseases, highlighting its potential in modulating immune responses and reducing inflammation. Additionally, its antioxidant capabilities suggest a role in protecting cells from oxidative stress-induced damage, which is relevant in neurodegenerative diseases and aging research. Overall, Ginsenoside Ra2 represents a promising compound for further investigation in pharmacology and therapeutic development.Formula:C58H98O26Purity:Min. 95%Molecular weight:1,211.38 g/mol