CAS 83480-64-2: Ginsenoside Rd2
Formula:C47H80O17
InChI:InChI=1S/C47H80O17/c1-22(2)10-9-14-47(8,64-42-39(58)36(55)34(53)27(62-42)21-60-40-37(56)32(51)25(50)20-59-40)23-11-16-46(7)31(23)24(49)18-29-44(5)15-13-30(43(3,4)28(44)12-17-45(29,46)6)63-41-38(57)35(54)33(52)26(19-48)61-41/h10,23-42,48-58H,9,11-21H2,1-8H3/t23-,24+,25-,26+,27+,28-,29+,30-,31-,32-,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,44-,45+,46+,47-/m0/s1
InChI key:InChIKey=ZTQSADJAYQOCDD-FDDSVCGKSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@@]([C@@](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@@H](O)[C@@H](O)CO5)[C@@H](O)[C@H](O)[C@H]4O)(CCC=C(C)C)C)(CC3)[H])([C@H](O)C[C@@]1([C@]6(C)[C@@](CC2)(C(C)(C)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)CC6)[H])[H])[H]
Synonyms:- Ginsenoside C-O
- β-D-Glucopyranoside, (3β,12β)-3-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-
- (3β,12β)-3-(β-D-Glucopyranosyloxy)-12-hydroxydammar-24-en-20-yl 6-O-α-L-arabinopyranosyl-β-D-glucopyranoside
- Ginsenoside Rd2
- Quinquenoside L10
Sort by
Found 4 products.
Ginsenoside Rd2
CAS:Ginsenoside Rd2 is a naturally occurring saponin, which is a type of triterpene glycoside, sourced from the root of the Panax ginseng plant. This compound is known for its bioactive properties and is composed primarily of a dammarane structure characterized by sugar moieties that contribute to its water solubility and bioavailability. The mode of action of Ginsenoside Rd2 involves the modulation of various signaling pathways, including anti-inflammatory and antioxidant activities. It influences cellular processes by interacting with membrane proteins and receptors, which in turn affects gene expression and cellular metabolism. Ginsenoside Rd2 is studied for its potential therapeutic applications, particularly in the realms of neuroprotection, cardiovascular health, and oncology. As a neuroprotective agent, it may inhibit neuronal apoptosis and ameliorate neuroinflammation, making it a candidate for research in degenerative diseases like Alzheimer's. In cardiovascular health, it may help in the regulation of blood pressure and the reduction of atherosclerotic plaque formation. Additionally, its capacity to modulate cell proliferation and induce apoptosis in cancer cells is of significant interest for oncological studies. Overall, Ginsenoside Rd2 is a promising compound with diverse pharmacological potentials warranting further investigation.Formula:C47H80O17Purity:Min. 95%Molecular weight:917.14 g/molGinsenoside Rd2
CAS:Ginsenoside Rd2 (Quinquenoside L10) is a natural product with Nourish the strong, calm the mind, nourish the body.Formula:C47H80O17Purity:98%Color and Shape:SolidMolecular weight:917.14
