
CAS 83846-48-4: 2-Chloro-4-iodo-1-methylbenzene
Formula:C7H6ClI
InChI:InChI=1S/C7H6ClI/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3
InChI key:InChIKey=PJYASWQMTNNSSL-UHFFFAOYSA-N
SMILES:ClC1=C(C)C=CC(I)=C1
Synonyms:- 1-Chloro-5-iodo-2-methylbenzene
- 2-Chloro-4-Iodo-1-Methylbenzene
- Benzene, 2-chloro-4-iodo-1-methyl-
- Toluene, 2-chloro-4-iodo-
- 2-Chloro-4-iodotoluene
Sort by
Found 4 products.
2-Chloro-4-iodo-1-methylbenzene
CAS:Formula:C7H6ClIPurity:98%Color and Shape:LiquidMolecular weight:252.482-Chloro-4-iodotoluene
CAS:2-Chloro-4-iodotoluene is a compound that belongs to the group of antibacterial agents. It has been shown to be effective against dermatological infections, such as acne and rosacea, and cutaneous diseases, such as eczema. 2-Chloro-4-iodotoluene inhibits bacterial growth by binding to DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. It also inhibits the production of prostaglandins (PGE2) in human skin cells, which may have anti-inflammatory effects. This compound is not active against acid-fast bacteria (e.g., Mycobacterium tuberculosis or Mycobacterium avium complex).Purity:Min. 95%Ref: 3D-FC138677
Discontinued product2-Chloro-4-iodotoluene
CAS:Purity:97.0%Color and Shape:Liquid, ClearMolecular weight:252.479995727539062-Chloro-4-iodotoluene
CAS:2-Chloro-4-iodotoluenePurity:98%Color and Shape:Colourless To Orange LiquidMolecular weight:252.48g/mol