CAS 83896-44-0: 18α-Glycyrrhizic acid
Formula:C42H62O16
InChI:InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21+,22+,23+,24+,25+,26+,27-,28+,29+,30-,31-,34+,35+,38-,39+,40+,41-,42-/m1/s1
InChI key:InChIKey=LPLVUJXQOOQHMX-IOHDZAKGSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@@H]4[C@H](O[C@@H]5O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O4)CC3)[H])(C(=O)C=C6[C@@]2(C)CC[C@]7(C)[C@@]6(C[C@](C(O)=O)(C)CC7)[H])[H]
Synonyms:- 18α-Glycyrrhizinic acid
- α-Glycyrrhizin
- 18α-Glycyrrhizin
- α-D-Glucopyranosiduronic acid, (3β,18α,20β)-20-carboxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-
- (3β,18α,20β)-20-Carboxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-α-D-glucopyranosiduronic acid
Sort by
Found 3 products.
18Alpha-Glycyrrhizic acid
CAS:18Alpha-Glycyrrhizic acid is a bioactive compound, which is derived from the roots of the Glycyrrhiza glabra plant, commonly known as licorice. It exerts its effects primarily through modulating inflammatory pathways by inhibiting enzymes like 11β-hydroxysteroid dehydrogenase. This inhibition prevents the conversion of cortisol to its inactive metabolite, leading to enhanced anti-inflammatory responses. 18Alpha-Glycyrrhizic acid is extensively studied for its therapeutic potential in treating inflammatory diseases, liver disorders, and certain viral infections. Its ability to modulate immune responses makes it a subject of interest in the development of treatments for autoimmune conditions. Furthermore, due to its antiviral properties, it is investigated for applications in managing conditions related to viral infections such as hepatitis. Despite its benefits, the use of 18Alpha-Glycyrrhizic acid requires careful consideration of its effects on mineralocorticoid activity, which can lead to side effects like hypertension if not monitored properly. Researchers continue to explore its full potential and optimize its therapeutic index.Formula:C42H62O16Purity:Min. 95%Molecular weight:822.9 g/mol
