
CAS 842959-64-2: (quinazolin-4-yloxy)acetic acid
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c13-9(14)5-15-10-7-3-1-2-4-8(7)11-6-12-10/h1-4,6H,5H2,(H,13,14)
SMILES:c1ccc2c(c1)c(ncn2)OCC(=O)O
Synonyms:- Acetic Acid, 2-(4-Quinazolinyloxy)-
Sort by
Found 3 products.
(QUINAZOLIN-4-YLOXY)ACETIC ACID
CAS:Formula:C10H8N2O3Purity:95%Color and Shape:SolidMolecular weight:204.1821(Quinazolin-4-yloxy)-acetic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:204.18499755859375(Quinazolin-4-yloxy)-acetic acid
CAS:Quinazolin-4-yloxy)-acetic acid is an immunogen that has been used to generate antibodies for the detection of cross-reactivity in a variety of plant, animal, and bacterial species. This compound is a quinazoline derivative that has been used to produce polyclonal antibodies and monoclonal antibodies. The antibody binds to a specific antigenic determinant on the surface of cells or viruses. Antibodies are produced by injecting animals with the immunogen under conditions that stimulate antibody production. These antibodies bind to the immunogen through their Fab regions and are used as probes in enzyme-linked immunosorbent assays (ELISA). This technique can be used to detect proteins, carbohydrates, lipids, or nucleic acids in complex biological samples.Formula:C10H8N2O3Purity:Min. 95%Molecular weight:204.2 g/mol