
CAS 84315-23-1: 3,5-Difluorocinnamic acid
Formula:C9H5F2O2
InChI:InChI=1/C9H6F2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H,12,13)/p-1/b2-1+
Synonyms:- 2-Propenoic Acid, 3-(3,5-Difluorophenyl)-
- 3-(3,5-Difluorophenyl)acrylic acid
- 3-(3,5-Difluorophenyl)Prop-2-Enoic Acid
Sort by
Found 3 products.
3,5-difluorocinnamic Acid
CAS:3,5-Difluorocinnamic Acid is a synthetic monomer that can be used to prepare a variety of organic compounds. The synthesis of 3,5-difluorocinnamic acid can be achieved by electrochemical methods in the presence of an electrolyte (e.g., KOH) and radiation (e.g., UV light), or by reacting phenylacetic acid with fluorine gas in the presence of an inorganic base (e.g., potassium fluoride). This molecule has two orientations, which are cis and trans. The molecular formula for 3,5-difluorocinnamic acid is C9H6F2O3.Formula:C9H6F2O2Purity:Min. 95%Molecular weight:184.14 g/mol3-(3,5-Difluorophenyl)acrylic acid
CAS:Formula:C9H6F2O2Purity:97%Color and Shape:SolidMolecular weight:184.13954639999994