
CAS 84365-55-9: Trichloro(indenyl)titanium(IV)
Formula:C9H7Cl3Ti
InChI:InChI=1/C9H7.3ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-7H;3*1H;/q;;;;+3/p-3/rC9H7Cl3Ti/c10-13(11,12)9-6-5-7-3-1-2-4-8(7)9/h1-6,9H
SMILES:c1ccc2[CH]C=Cc2c1.Cl.Cl.Cl.[Ti]
Synonyms:- Indenyltitaniumtrichloride
- trichloro(1H-inden-1-yl)titanium
Sort by
Found 4 products.
TRICHLORO(INDENYL)TITANIUM(IV)
CAS:Formula:C9H7Cl3TiPurity:98%Color and Shape:LiquidMolecular weight:269.3779(Indenyl)titanium(IV) Trichloride
CAS:Indenyl titanium (IV) trichloride is a metal complex that is used as a cocatalyst in the polymerization of vinyl alcohol, styrene, and hydrocarbons. It has been shown to form crystalline structures in the solid state and has a melting point of over 300°C. This complex can be used to copolymerize styrene with other monomers such as vinyl acetate and methyl methacrylate to form polystyrene. This compound is also known for its 13C-NMR spectroscopy, which was used to determine the structure of the molecule.Formula:C9H7Cl3TiPurity:Min. 95%Molecular weight:269.38 g/mol(Indenyl)titanium(IV) Trichloride
CAS:Formula:C9H7Cl3TiPurity:>98.0%(T)(W)Color and Shape:Dark green to Dark purple to Black powder to crystalMolecular weight:269.37Indenyltitanium trichloride, 99%
CAS:Indenyltitanium trichloride, 99%Formula:C9H7TiCl3Purity:99%Color and Shape:purple xtl.Molecular weight:269.39