
CAS 84713-20-2: benzyl ethenylcarbamate
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c1-2-11-10(12)13-8-9-6-4-3-5-7-9/h2-7H,1,8H2,(H,11,12)
SMILES:C=CN=C(O)OCc1ccccc1
Synonyms:- Benzyl N-vinylcarbamate
Sort by
Found 5 products.
Benzyl vinylcarbamate
CAS:Benzyl vinylcarbamateFormula:C10H11NO2Purity:By gc: 99.44% (gc fid) (Typical Value in Batch COA)Color and Shape: white to off white solidMolecular weight:177.20g/molBenzyl Vinylcarbamate
CAS:Benzyl Vinylcarbamate is an epoxide and carbamate that has been shown to have carcinogenic potential. It is metabolized in the liver by cytochrome P450 enzymes into a reactive intermediate that binds to DNA, causing mutations and ultimately cell death. The benzyl vinylcarbamate molecule also reacts with other molecules, such as sodium carbonate, to form epoxides. These epoxides can bind to DNA, causing mutations and eventually leading to cell death. Benzyl Vinylcarbamate has been shown to cause lung tumors in mice at low doses.Formula:C10H11NO2Purity:Min. 95%Color and Shape:SolidMolecular weight:177.2 g/molRef: 3D-FB141802
Discontinued productBenzyl N-vinylcarbamate
CAS:Formula:C10H11NO2Purity:95%Color and Shape:SolidMolecular weight:177.1998