
CAS 849020-92-4: methyl 2-(aminomethyl)benzoate hydrochloride
Formula:C9H12ClNO2
InChI:InChI=1/C9H11NO2.ClH/c1-12-9(11)8-5-3-2-4-7(8)6-10;/h2-5H,6,10H2,1H3;1H
SMILES:COC(=O)c1ccccc1CN.Cl
Synonyms:- Benzoic acid, 2-(aminomethyl)-, methyl ester, hydrochloride (1:1)
- Methyl 2-(aminomethyl)benzoate hydrochloride (1:1)
Sort by
Found 4 products.
2-Carbomethoxybenzylamine hydrochloride
CAS:2-Carbomethoxybenzylamine hydrochloride is a versatile compound with various applications. It exhibits cytotoxic properties, making it useful in cancer research and drug development. Additionally, it has anticoagulant properties, which can be beneficial in the treatment of certain medical conditions. This compound can also act as a proton donor and acceptor, making it valuable in chemical reactions that require proton transfer. Its anticoagulant properties make it an effective electrode for blood analysis and other related applications. Furthermore, 2-Carbomethoxybenzylamine hydrochloride has been studied for its potential as a serine protease inhibitor. Serine proteases play a crucial role in many biological processes, so inhibiting their activity can have therapeutic implications. In addition to its biomedical applications, this compound is also used in research settings as a precursor or starting material for the synthesis of other chemicals. Its versatility and wide range of potential uses make 2-CarbomethoxyFormula:C9H12ClNO2Purity:Min. 95%Molecular weight:201.65 g/mol2-CARBOMETHOXYBENZYLAMINEHYDROCHLORIDE
CAS:Formula:C9H12ClNO2Purity:95%Color and Shape:SolidMolecular weight:201.65012-Carbomethoxybenzylamine hydrochloride
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:201.64999389648438Methyl 2-(aminomethyl)benzoate hydrochloride
CAS:Methyl 2-(aminomethyl)benzoate hydrochlorideFormula:C9H11NO2·ClHPurity:95+%Color and Shape: white solidMolecular weight:201.65g/mol