
CAS 849062-12-0: (3-bromo-5-methoxyphenyl)boronic acid
Formula:C7H8BBrO3
InChI:InChI=1/C7H8BBrO3/c1-12-7-3-5(8(10)11)2-6(9)4-7/h2-4,10-11H,1H3
SMILES:COc1cc(cc(c1)Br)B(O)O
Synonyms:- 3-Bromo-5-methoxyphenylboronic acid
- 3-Bromo-5-methoxybenzene boronic acid
Sort by
Found 4 products.
(3-Bromo-5-methoxyphenyl)boronic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:230.850006103515623-Bromo-5-methoxybenzeneboronic acid
CAS:3-Bromo-5-methoxybenzeneboronic acidPurity:97+%Molecular weight:230.85g/mol3-Bromo-5-methoxyphenylboronic acid
CAS:3-Bromo-5-methoxyphenylboronic acid is a hydrophobic organic molecule. It can be used in the synthesis of fluorescent dyes and other molecules with hydrophobic properties. 3-Bromo-5-methoxyphenylboronic acid is a small molecule that has a diameter of 1.7 nm and an energy transfer distance of 2.8 nm, which are both less than the typical energy transfer distances for aromatic systems. It is soluble in many solvents, such as water or methanol, but not in others, such as hexane or acetone. This compound has been shown to form dimers when dissolved in water at a concentration greater than 0.1 M and under conditions where the pH is greater than 8.br>br> 3-Bromo-5-methoxyphenylboronic acid has been synthesized by reacting phenyl boronic acid with 3-Formula:C7H8BBrO3Purity:Min. 95%Molecular weight:230.85 g/molRef: 3D-FB160686
Discontinued product(3-Bromo-5-methoxyphenyl)boronic acid
CAS:Formula:C7H8BBrO3Purity:96%Color and Shape:SolidMolecular weight:230.8516