
CAS 85014-02-4: cyclohexyl(4-fluorophenyl)methanone
Formula:C13H15FO
InChI:InChI=1/C13H15FO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h6-10H,1-5H2
SMILES:C1CCC(CC1)C(=O)c1ccc(cc1)F
Sort by
Found 3 products.
Cyclohexyl(4-fluorophenyl)methanone
CAS:Cyclohexyl(4-fluorophenyl)methanoneMolecular weight:206.256g/mol4-Fluorophenyl cyclohexyl ketone
CAS:Purity:95.0%Color and Shape:Liquid, OilMolecular weight:206.25999450683594Cyclohexyl(4-fluorophenyl)methanone
CAS:Cyclohexyl(4-fluorophenyl)methanone is a chemical with antimitotic activity. Cyclohexyl(4-fluorophenyl)methanone has been shown to inhibit the growth of various types of human cancer cells in vitro, including those resistant to other anticancer drugs. This compound has also been shown to cause cell cycle arrest and apoptosis in various human cancer cells. The antimitotic properties of cyclohexyl(4-fluorophenyl)methanone are attributed to its ability to bind and activate topoisomerase II. This causes DNA strand breaks, leading to apoptosis.Formula:C13H15FOPurity:Min. 95%Molecular weight:206.26 g/mol