CAS 85022-69-1: Cinchonain Ib
Formula:C24H20O9
InChI:InChI=1S/C24H20O9/c25-14-3-1-10(5-17(14)28)12-8-21(31)32-20-9-16(27)13-7-19(30)23(33-24(13)22(12)20)11-2-4-15(26)18(29)6-11/h1-6,9,12,19,23,25-30H,7-8H2/t12-,19+,23+/m0/s1
InChI key:InChIKey=LKCOZWLUAKSRQM-IBUUURQNSA-N
SMILES:OC=1C2=C(C=3[C@@H](CC(=O)OC3C1)C4=CC(O)=C(O)C=C4)O[C@@H]([C@H](O)C2)C5=CC(O)=C(O)C=C5
Synonyms:- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, [2R-(2α,3α,10β)]-
- Cinchonain Ib
- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, (2R,3R,10S)-
- (2R,3R,10S)-2,10-Bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-2H,8H-benzo[1,2-b:3,4-b′]dipyran-8-one
Sort by
Found 4 products.
Cinchonain Ib
CAS:Cinchonain Ib is isolated from Eriobotrya japonica leaves.Formula:C24H20O9Purity:98%Color and Shape:SolidMolecular weight:452.41Cinchonain IB
CAS:Cinchonain IB is a complex natural product, which is derived from the bark of the Cinchona tree. This tree has historically been significant due to its medicinal properties, particularly in the treatment of malaria. The compound belongs to the class of chemical substances known as flavonoid dimers, specifically sourced from Cinchona species. Cinchonain IB functions primarily through its bioactive properties, which include potential antioxidant and anti-inflammatory effects. Its mode of action is attributed to its ability to interact with biological macromolecules, thereby modulating various biochemical pathways. Research into Cinchonain IB is focused on exploring its uses in pharmacology. Scientists are investigating its potential applications in the development of therapeutic agents, particularly for diseases where oxidative stress and inflammation play crucial roles. This includes neurodegenerative diseases, cardiovascular diseases, and other chronic conditions. Given its natural origin and complex bioactivity, Cinchonain IB represents a promising candidate for further study in drug discovery and development.Formula:C24H20O9Purity:Min. 95%Molecular weight:452.4 g/mol2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihydroxy-, (2R,3R,10S)-
CAS:Formula:C24H20O9Purity:97.5%Molecular weight:452.4102Cinchonain ib
CAS:Oxygen-heterocyclic compoundFormula:C24H20O9Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:452.41
![2H,8H-Benzo[1,2-b:3,4-b′]dipyran-8-one, 2,10-bis(3,4-dihydroxyphenyl)-3,4,9,10-tetrahydro-3,5-dihy…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA01RKQR.jpg&w=3840&q=75)
