
CAS 852180-74-6: 3-pyrimidin-5-ylbenzoic acid
Formula:C11H8N2O2
InChI:InChI=1/C11H8N2O2/c14-11(15)9-3-1-2-8(4-9)10-5-12-7-13-6-10/h1-7H,(H,14,15)
SMILES:c1cc(cc(c1)C(=O)O)c1cncnc1
Synonyms:- 3-(Pyrimidin-5-yl)benzoic acid
- Benzoic acid, 3-(5-pyrimidinyl)-
Sort by
Found 4 products.
3-(5-Pyrimidinyl)benzoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:200.197006225585943-Pyrimidin-5-yl-benzoic acid
CAS:3-Pyrimidin-5-yl-benzoic acid is an organoboron compound that has been shown to be a ligand for metal ions in two-dimensional, three-dimensional, and supramolecular structures. It is also used as a fluorescent probe to detect metal ions and other molecules in polymers, which can be achieved by using spectroscopy or x-ray crystallography. 3-Pyrimidin-5-yl-benzoic acid has been shown to coordinate with various metal ions such as Ti2+, Mn2+, Cu2+, Fe3+, Co2+, Ni2+, Zn2+, Cd2+, Hg2+, Pb2+ and Ag+. This chemical compound is also able to form coordination complexes with polymer chains and other organic molecules.Formula:C11H8N2O2Purity:Min. 95%Molecular weight:200.19 g/molRef: 3D-FP154084
Discontinued product3-Pyrimidin-5-yl-benzoic acid
CAS:Formula:C11H8N2O2Purity:97%Color and Shape:SolidMolecular weight:200.19343-Pyrimidin-5-ylbenzoic acid
CAS:3-Pyrimidin-5-ylbenzoic acidFormula:C11H8N2O2Purity:97%Color and Shape: off-white powderMolecular weight:200.19g/mol