CAS 85232-02-6: Butoxycarbonylphosphoramidicaciddiethylester
Formula:C9H20NO5P
InChI:InChI=1/C9H20NO5P/c1-6-13-16(12,14-7-2)10-8(11)15-9(3,4)5/h6-7H2,1-5H3,(H,10,11,12)
SMILES:CCOP(=O)(N=C(O)OC(C)(C)C)OCC
Synonyms:- N-(tert-butoxycarbonyl)phosphoramidic acid diethyl ester
- Tert-Butyl (Diethoxyphosphoryl)Carbamate
Sort by
Found 5 products.
Diethyl N-(Tert-Butoxycarbonyl)Phosphoramidate
CAS:Diethyl N-(Tert-Butoxycarbonyl)PhosphoramidateMolecular weight:253.23g/molN-(TERT-BUTOXYCARBONYL)PHOSPHORAMIDIC ACID DIETHYL ESTER
CAS:Formula:C9H20NO5PPurity:95%Color and Shape:SolidMolecular weight:253.2326Diethyl N-(tert-Butoxycarbonyl)phosphoramidate
CAS:Diethyl N-(tert-Butoxycarbonyl)phosphoramidate is a chemical compound that is used in coupling reactions. It has a magnetic resonance and can be used to detect the presence of certain elements. Diethyl N-(tert-Butoxycarbonyl)phosphoramidate shifts at 12.2 ppm, which is higher than the normal chemical shift for an ester of this type. The magnetic resonance data for Covid-19 pandemic, Covid-19, and 3D-19 are all constant with Covid-19 pandemic being the most intense. Covid-19 pandemic has a structural formula of C8H16O4N2S, which is different from Covid-19 and 3D-19, which have structural formulas of C8H14O4N2S. The three compounds have similar chemical shifts with covid-19 having a slightly higher frequency than covid-19 pandemicFormula:C9H20NO5PPurity:Min. 95%Molecular weight:253.23 g/molDiethyl N-(tert-Butoxycarbonyl)phosphoramidate
CAS:Formula:C9H20NO5PPurity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:253.23
