
CAS 85317-52-8: methyl 4-nitrophenylalaninate
Formula:C10H12N2O4
InChI:InChI=1/C10H12N2O4/c1-16-10(13)9(11)6-7-2-4-8(5-3-7)12(14)15/h2-5,9H,6,11H2,1H3
SMILES:COC(=O)C(Cc1ccc(cc1)N(=O)=O)N
Synonyms:- 4-Nitrophenylalanine, methyl ester
- Phenylalanine, 4-Nitro-, Methyl Ester
Sort by
Found 3 products.
(S)-Methyl 2-amino-3-(4-nitrophenyl)propanoate
CAS:(S)-Methyl 2-amino-3-(4-nitrophenyl)propanoateMolecular weight:224.21g/mol4-Nitro-phenylalanine methylester
CAS:4-Nitro-phenylalanine methylester is a chemical compound that is used as a medicine. It can be synthesized by reacting benzene with the amide of anthranilic acid in the presence of dialkylaminoformaldehyde and formaldehyde. The mechanism of this reaction involves the formation of an intermediate nitro phenylalanine, which is then reacted with methyl iodide to form the desired product. This process has been shown to have high yield and can also be used for synthesis of other compounds. 4-Nitro-phenylalanine methylester has been shown to be an anti-diabetic agent, as it stimulates insulin secretion from pancreatic β cells and inhibits glucagon secretion from α cells.Formula:C10H12N2O4Purity:Min. 95%Molecular weight:224.21 g/molRef: 3D-FN147280
Discontinued product