
CAS 858001-69-1: 1-(2-aminoethyl)urea hydrochloride
Formula:C3H10ClN3O
InChI:InChI=1/C3H9N3O.ClH/c4-1-2-6-3(5)7;/h1-2,4H2,(H3,5,6,7);1H
SMILES:C(CNC(=N)O)N.Cl
Synonyms:- 1-(2-Aminoethyl)urea hydrochloride (1:1)
- Urea, N-(2-aminoethyl)-, hydrochloride (1:1)
Sort by
Found 5 products.
(2-Amino-ethyl)-urea hydrochloride
CAS:Purity:98.0%Color and Shape:Solid, CrystallineMolecular weight:139.5800018310547(2-Aminoethyl)urea hydrochloride
CAS:Formula:C3H10ClN3OPurity:95%Color and Shape:SolidMolecular weight:139.584(2-Amino-ethyl)-urea hydrochloride
CAS:(2-Amino-ethyl)-urea hydrochloride is a ligand that binds to the nitro group of the aromatic amine, phenylhydrazine. This binding prevents the formation of reactive oxygen species, which are involved in neurodegeneration and cancer. The affinity for the ligand is determined by steric factors, with methyl ester being more potent than ethyl ester. The 2-aminoethyl urea ligand binds to the carboxylate region of phenylhydrazine and inhibits its activity.Formula:C3H10ClN3OPurity:Min. 95%Molecular weight:139.58 g/mol