
CAS 86427-02-3: 3-Chlorothiophene-2-carbonyl chloride
Formula:C5H2Cl2OS
InChI:InChI=1/C5H2Cl2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H
SMILES:c1csc(c1Cl)C(=O)Cl
Synonyms:- 2-Thiophenecarbonyl chloride, 3-chloro-
Sort by
Found 3 products.
3-Chlorothiophene-2-carbonyl chloride
CAS:Purity:98.0%Color and Shape:SolidMolecular weight:181.029998779296883-Chlorothiophene-2-carbonylchloride
CAS:3-Chlorothiophene-2-carbonylchloride (3C2CC) is a heterobicyclic compound that is a ligand for the amine receptor. It is also used as an intermediate in the synthesis of other heterocycles. 3C2CC has been shown to interact with amines to form a nitrene, which can be detected by luminescence or x-ray diffraction techniques. 3C2CC interacts with chloride ions to form a crystal that has a different x-ray diffraction pattern from the one obtained from chloride alone. The crystal structure of this complex was determined using x-ray crystallography.Formula:C5H2Cl2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:181.04 g/mol3-Chlorothiophene-2-carbonyl chloride
CAS:3-Chlorothiophene-2-carbonyl chloridePurity:95%Molecular weight:181.04g/mol