
CAS 86581-30-8: 7-fluorohexadecanoic acid
Formula:C16H31FO2
InChI:InChI=1/C16H31FO2/c1-2-3-4-5-6-7-9-12-15(17)13-10-8-11-14-16(18)19/h15H,2-14H2,1H3,(H,18,19)
SMILES:CCCCCCCCCC(CCCCCC(=O)O)F
Sort by
Found 1 products.
7-Fluorohexadecanoic acid
CAS:7-Fluorohexadecanoic acid is a fatty acid that is synthesized by a sequence of reactions, including the fluorination of hexadecanoic acid and the benzyl esterification of palmitic acid. The synthesis begins with the introduction of a fluoride atom to one end of the carbon chain. This molecule is then reacted with methanesulfonic anhydride in the presence of zinc chloride to produce 7-fluorohexadecanoic acid. The final step includes hydrolysis, which breaks down 7-fluorohexadecanoic acid into palmitic and hexadecanoic acids.Formula:C16H31FO2Purity:Min. 95%Molecular weight:274.41 g/mol