
CAS 86884-16-4: 1,1,1,2,4,4,4-heptafluorobutane
Formula:C4H3F7
InChI:InChI=1/C4H3F7/c5-2(4(9,10)11)1-3(6,7)8/h2H,1H2
SMILES:C(C(C(F)(F)F)F)C(F)(F)F
Synonyms:- Butane, 1,1,1,2,4,4,4-heptafluoro-
- 1,1,1,2,4,4,4-Heptafluorobutane
Sort by
Found 2 products.
1,1,1,2,4,4,4-Heptafluorobutane
CAS:1,1,1,2,4,4,4-HeptafluorobutanePurity:97%Molecular weight:184.06g/mol1,1,1,2,4,4,4-Heptafluorobutane
CAS:1,1,1,2,4,4,4-Heptafluorobutane is a fluorinated compound that is commonly used as a solvent. It has shown to be an effective surfactant in the ozonosphere and can be used to remove hydrocarbons from contaminated water. The 1,1,1,2,4,4,4-Heptafluorobutane is soluble in both water and nonpolar solvents such as alkanes. It is also linear with no branching of the carbon chain. This surfactant is nonionic and has a hydrophilic head group. The hydrocarbon solvent contains only hydrogen atoms and no fluorine atoms. 1,1,1,2,4,4,4-Heptafluorobutane does not contain any fluorine atoms but does have hydrogen and carbon atoms that are chemically bonded to each other. This surface active agent has been shown to reduce the surfaceFormula:C4H3F7Purity:Min. 95%Molecular weight:184.06 g/mol