CAS 876-53-9: 1,3-dibromoadamantane
Formula:C10H14Br2
InChI:InChI=1/C10H14Br2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8H,1-6H2
SMILES:C1C2CC3(CC1CC(C2)(C3)Br)Br
Synonyms:- Dibromoadamantane,97%
- Dibromoadamantane
- 1,3-Dibromotricyclo[3.3.1.1~3,7~]Decane
Sort by
Found 11 products.
1,3-Dibromoadamantane
CAS:1,3-Dibromoadamantane is an organic compound that belongs to the group of organobromides. It has a chemical structure with three bromine atoms and one carbon atom, which are bonded to each other in a triangle shape. 1,3-Dibromoadamantane is soluble in solvents such as water and methanol. The reaction yield of 1,3-dibromoadamantane is 100% when it reacts with hydrochloric acid as the catalyst under optimal conditions. The reaction also occurs at a high temperature (100 degrees Celsius) and releases energy efficiently. 1,3-Dibromoadamantane can be used as a substrate molecule for the Suzuki coupling reaction. The coordination chemistry of 1,3-dibromoadamantane involves the formation of a square planar complex with copper ions and ammonia molecules to form copper(I) ammine complexes, which are then able to bindFormula:C10H14Br2Purity:Min. 95%Color and Shape:PowderMolecular weight:294.03 g/mol1,3-Dibromoadamantane
CAS:Controlled ProductApplications 1,3-Dibromoadamantane (cas# 876-53-9) is a compound useful in organic synthesis.Formula:C10H14Br2Color and Shape:NeatMolecular weight:294.031,3-Dibromoadamantane (purified by sublimation)
CAS:Formula:C10H14Br2Purity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:294.031,3-Dibromoadamantane
CAS:Formula:C10H14Br2Purity:>97.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:294.03
