CAS 87764-46-3: 3-Deoxy-3-Fluoro-D-Mannose
Formula:C6H11FO5
InChI:InChI=1/C6H11FO5/c7-5(3(10)1-8)6(12)4(11)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6-/m1/s1
SMILES:C(=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)F)O
Synonyms:- (2R,3S,4R,5R)-3-fluoro-2,4,5,6-tetrahydroxy-hexanal
Sort by
Found 5 products.
3-Deoxy-3-fluoro-D-mannose
CAS:Controlled ProductApplications Shown to be metabolized in yeast. References Biochem. J., 209 (3), 677-685 (1983)Formula:C6H11FO5Color and Shape:NeatMolecular weight:182.153-Deoxy-3-fluoro-D-mannose
CAS:3-Deoxy-3-fluoro-D-mannose (3DFM) is a synthetic sugar molecule that acts as an inhibitor of bacterial growth. It binds to the 6-phosphate group of nucleic acids, which prevents the addition of sugar molecules to ribose or deoxyribose groups. 3DFM also inhibits the synthesis of proteins and RNA, which are necessary for bacterial growth. 3DFM is a structural analog of mannose and glucose, and has been shown to be effective against chronic infections caused by bacteria that produce lectins, such as C. difficile. This drug can be used in combination with other antibiotics to enhance their effectiveness.Formula:C6H11FO5Purity:Min. 95%Color and Shape:PowderMolecular weight:182.15 g/molD-Mannose,3-deoxy-3-fluoro-
CAS:Formula:C6H11FO5Purity:97%Color and Shape:SolidMolecular weight:182.1469432
