CAS 88353-04-2: 1-(Phenylmethyl) dodecanedioate
Formula:C19H28O4
InChI:InChI=1S/C19H28O4/c20-18(21)14-10-5-3-1-2-4-6-11-15-19(22)23-16-17-12-8-7-9-13-17/h7-9,12-13H,1-6,10-11,14-16H2,(H,20,21)
InChI key:InChIKey=ZDTVBXVYNIHVNR-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCC(O)=O)=O)C1=CC=CC=C1
Synonyms:- Dodecanedioic acid, 1-(phenylmethyl) ester
- 11-(Benzyloxycarbonyl)undecanoic acid
- 1-(Phenylmethyl) dodecanedioate
- Dodecanedioic acid, mono(phenylmethyl) ester
- Monobenzyl dodecanedioate
Sort by
Found 4 products.
12-(Benzyloxy)-12-Oxododecanoic Acid
CAS:12-(Benzyloxy)-12-Oxododecanoic AcidPurity:97%Molecular weight:320.42g/mol12-(Benzyloxy)-12-oxododecanoic acid
CAS:12-(Benzyloxy)-12-oxododecanoic acid is a synthetic molecule that encompasses an acyl chain of 12 carbon atoms, which is attached to dodecanedioic acid. This molecule has been shown to act as a vaccine adjuvant and has been used in clinical trials for the prevention of infectious diseases. The vaccine adjuvant increases the effectiveness of vaccines by stimulating immune responses, such as antibody production and activation of T cells. The molecule also has the ability to bind to saponins, which are found in plants, but not humans. This allows it to be used in oral vaccines without causing adverse reactions. 12-(Benzyloxy)-12-oxododecanoic acid is synthesized by linking a benzyl ester group with an acid conjugate or complex, creating a linker that contains both hydrophobic and hydrophilic properties.Formula:C19H28O4Purity:Min. 95%Color and Shape:PowderMolecular weight:320.42 g/molDodecanedioic acid, mono(phenylmethyl) ester
CAS:Formula:C19H28O4Purity:98%Color and Shape:SolidMolecular weight:320.4232
