CAS 885274-12-4: 4-Oxazolecarboxylic acid, hydrazide
Formula:C4H5N3O2
InChI:InChI=1S/C4H5N3O2/c5-7-4(8)3-1-9-2-6-3/h1-2H,5H2,(H,7,8)
InChI key:InChIKey=BJKXXQQGEZGQSQ-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=COC=N1
Synonyms:- 1,3-Oxazole-4-carbohydrazide
- 4-Oxazolecarboxylic acid, hydrazide
- Oxazole-4-carbohydrazide
Sort by
Found 5 products.
Oxazole-4-carbohydrazide
CAS:Controlled ProductApplications oxazole-4-carbohydrazide (cas# 885274-12-4) is a useful research chemical.Formula:C4H5N3O2Color and Shape:NeatMolecular weight:127.1Oxazole-4-carbohydrazide
CAS:Formula:C4H5N3O2Purity:97%Color and Shape:SolidMolecular weight:127.1014Oxazole-4-carboxylic acid hydrazide
CAS:Oxazole-4-carboxylic acid hydrazide is an organic compound that belongs to the group of hydrazides. It is a white powder and is soluble in water. Oxazole-4-carboxylic acid hydrazide is used as a precursor for the synthesis of other compounds, such as oxazoles and multicenter functional derivatives. The conversion of oxazole-4-carboxylic acid hydrazide to a desired product can be achieved by reacting it with an appropriate hydrazine or hydroxylamine. Preparative purification can be achieved by crystallization from an appropriate solvent, such as ethanol or acetone.Formula:C4H5N3O2Purity:Min. 95%Molecular weight:127.1 g/molRef: 3D-FO56602
Discontinued product
