
CAS 887584-98-7: 3,4-difluoro-5-methoxy-benzoic acid
Formula:C8H6F2O3
InChI:InChI=1/C8H6F2O3/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3H,1H3,(H,11,12)
SMILES:COc1cc(cc(c1F)F)C(=O)O
Synonyms:- 3,4-Difluoro-5-methoxybenzoic acid
- 4,5-Difluoro-3-methoxybenzoic acid
- Benzoic Acid, 3,4-Difluoro-5-Methoxy-
Sort by
Found 4 products.
3,4-Difluoro-5-methoxybenzoic acid
CAS:3,4-Difluoro-5-methoxybenzoic acid is a reactive compound that is produced as a Grignard reagent. It reacts with other organic compounds to form new compounds. 3,4-Difluoro-5-methoxybenzoic acid contains the methoxy group, which is found in many drugs. The methoxy group can be removed from 3,4-Difluoro-5-methoxybenzoic acid by reacting it with an alkali metal such as sodium hydroxide to produce 3,4-dihydroxybenzoic acid.Formula:C8H6F2O3Purity:Min. 95%Molecular weight:188.13 g/mol3,4-Difluoro-5-methoxybenzoic acid
CAS:Formula:C8H6F2O3Purity:97%Color and Shape:SolidMolecular weight:188.12823,4-Difluoro-5-methoxybenzoic acid
CAS:3,4-Difluoro-5-methoxybenzoic acidPurity:95%Molecular weight:188.13g/mol