
CAS 89059-06-3: 3-(1H-pyrrol-1-yl)propanoic acid
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c9-7(10)3-6-8-4-1-2-5-8/h1-2,4-5H,3,6H2,(H,9,10)
SMILES:c1ccn(c1)CCC(=O)O
Synonyms:- 1H-pyrrole-1-propanoic acid
- N-(2-carboxyethyl)pyrrole
Sort by
Found 4 products.
3-(1H-Pyrrol-1-yl)propanoic acid
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:139.1540069580078Pyrrole-1-propionic acid
CAS:Pyrrole-1-propionic acidPurity:97%Color and Shape:SolidMolecular weight:139.15g/mol3-(1H-Pyrrol-1-yl)propanoic acid
CAS:3-(1H-Pyrrol-1-yl)propanoic acid is a polymerized, immobilized, and hydrophilic monomer. It can be used in the electropolymerization technique to produce polymers that are soluble in water. 3-(1H-Pyrrol-1-yl)propanoic acid has been shown to have a high degree of crystallinity and a high molecular weight. The polymerization process can be controlled by changing the concentrations of the monomers or copolymerizing with other compounds such as dopamine. 3-(1H-Pyrrol-1-yl)propanoic acid is also used for the synthesis of paclitaxel, an anticancer drug. Paclitaxel is synthesized from 3-(1H-pyrrol-1-yl)propanoic acid and 1,2,3,4,5,6 - hexahydrobenzocycloheptenoneFormula:C7H9NO2Purity:Min. 95%Molecular weight:139.15 g/molRef: 3D-FP122087
Discontinued product